C20H30O3 — CID 139060461
(4aR,4bS,8aR,8bR,9R,12aS,12bR)-9-ethyl-12a-hydroxy-3,4,4a,4b,6,7,8,8a,8b,9,10,11,12,12b-tetradecahydro-2H-triphenylene-1,5-dione (PubChem CID 139060461) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4aR,4bS,8aR,8bR,9R,12aS,12bR)-9-ethyl-12a-hydroxy-3,4,4a,4b,6,7,8,8a,8b,9,10,11,12,12b-tetradecahydro-2H-triphenylene-1,5-dione.
| Compound Name | (4aR,4bS,8aR,8bR,9R,12aS,12bR)-9-ethyl-12a-hydroxy-3,4,4a,4b,6,7,8,8a,8b,9,10,11,12,12b-tetradecahydro-2H-triphenylene-1,5-dione |
|---|---|
| PubChem CID | 139060461 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4aR,4bS,8aR,8bR,9R,12aS,12bR)-9-ethyl-12a-hydroxy-3,4,4a,4b,6,7,8,8a,8b,9,10,11,12,12b-tetradecahydro-2H-triphenylene-1,5-dione |
| SMILES | CC[C@@H]1CCC[C@]2(O)[C@H]1[C@H]1CCCC(=O)[C@@H]1[C@H]1CCCC(=O)[C@H]12 |
| InChI | InChI=1S/C20H30O3/c1-2-12-6-5-11-20(23)18(12)13-7-3-9-15(21)17(13)14-8-4-10-16(22)19(14)20/h12-14,17-19,23H,2-11H2,1H3/t12-,13+,14-,17+,18-,19+,20+/m1/s1 |
| InChIKey | AXJMXBGOFKKPOB-MPHMRHGLSA-N |
| XLogP | 3.53 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |