About 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one
5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one (PubChem CID 55286079) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one.
Analyze 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one?
The IUPAC name of 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one (CID 55286079) is 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one.
What is the SMILES notation for 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one?
The canonical SMILES for 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one is O=C1C=C2NCCCC2O1.
What is the InChIKey of 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one?
The InChIKey is VZLGWVTXIMMSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c9-7-4-5-6(10-7)2-1-3-8-5/h4,6,8H,1-3H2.
What are the key properties of 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one?
5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one has a molecular weight of 139.15 g/mol, XLogP of 0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7,7a-tetrahydro-4H-furo[3,2-b]pyridin-2-one is sourced from PubChem (CID 55286079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).