About (4R)-4-aminoazepan-2-one
(4R)-4-aminoazepan-2-one (PubChem CID 18648126) has the molecular formula C6H12N2O
and a molecular weight of 128.18 g/mol. Its IUPAC name is (4R)-4-aminoazepan-2-one.
Molecular Properties
| Compound Name | (4R)-4-aminoazepan-2-one |
| PubChem CID | 18648126 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (4R)-4-aminoazepan-2-one |
| SMILES | N[C@@H]1CCCNC(=O)C1 |
| InChI | InChI=1S/C6H12N2O/c7-5-2-1-3-8-6(9)4-5/h5H,1-4,7H2,(H,8,9)/t5-/m1/s1 |
| InChIKey | VTQGYRVGBASLDF-RXMQYKEDSA-N |
| XLogP | -0.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-4-aminoazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-aminoazepan-2-one?
The IUPAC name of (4R)-4-aminoazepan-2-one (CID 18648126) is (4R)-4-aminoazepan-2-one.
What is the SMILES notation for (4R)-4-aminoazepan-2-one?
The canonical SMILES for (4R)-4-aminoazepan-2-one is N[C@@H]1CCCNC(=O)C1.
What is the InChIKey of (4R)-4-aminoazepan-2-one?
The InChIKey is VTQGYRVGBASLDF-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H12N2O/c7-5-2-1-3-8-6(9)4-5/h5H,1-4,7H2,(H,8,9)/t5-/m1/s1.
What are the key properties of (4R)-4-aminoazepan-2-one?
(4R)-4-aminoazepan-2-one has a molecular weight of 128.18 g/mol, XLogP of -0.39, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-aminoazepan-2-one is sourced from PubChem (CID 18648126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).