C10H20N4O2 — CID 101477400
trans-(3R,9R)-3,9-diamino-1,7-diazacyclododecane-2,8-dione (PubChem CID 101477400) has the molecular formula C10H20N4O2 and a molecular weight of 228.30 g/mol. Its IUPAC name is trans-(3R,9R)-3,9-diamino-1,7-diazacyclododecane-2,8-dione.
| Compound Name | trans-(3R,9R)-3,9-diamino-1,7-diazacyclododecane-2,8-dione |
|---|---|
| PubChem CID | 101477400 |
| Molecular Formula | C10H20N4O2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | trans-(3R,9R)-3,9-diamino-1,7-diazacyclododecane-2,8-dione |
| SMILES | N[C@@H]1CCCNC(=O)[C@H](N)CCCNC1=O |
| InChI | InChI=1S/C10H20N4O2/c11-7-3-1-5-13-10(16)8(12)4-2-6-14-9(7)15/h7-8H,1-6,11-12H2,(H,13,16)(H,14,15)/t7-,8-/m1/s1 |
| InChIKey | NWDFWCXKIDTJBA-HTQZYQBOSA-N |
| XLogP | -1.55 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |