C7H14N2O3 — CID 139269691
acetic acid;3-aminopiperidin-2-one (PubChem CID 139269691) has the molecular formula C7H14N2O3 and a molecular weight of 174.20 g/mol. Its IUPAC name is acetic acid;3-aminopiperidin-2-one.
| Compound Name | acetic acid;3-aminopiperidin-2-one |
|---|---|
| PubChem CID | 139269691 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | acetic acid;3-aminopiperidin-2-one |
| SMILES | CC(=O)O.NC1CCCNC1=O |
| InChI | InChI=1S/C5H10N2O.C2H4O2/c6-4-2-1-3-7-5(4)8;1-2(3)4/h4H,1-3,6H2,(H,7,8);1H3,(H,3,4) |
| InChIKey | HADNULNRTAVUQU-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |