C17H25N3O3 — CID 70056885
benzyl 7-amino-6-oxo-1,5-diazacycloundecane-1-carboxylate (PubChem CID 70056885) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is benzyl 7-amino-6-oxo-1,5-diazacycloundecane-1-carboxylate.
| Compound Name | benzyl 7-amino-6-oxo-1,5-diazacycloundecane-1-carboxylate |
|---|---|
| PubChem CID | 70056885 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | benzyl 7-amino-6-oxo-1,5-diazacycloundecane-1-carboxylate |
| SMILES | NC1CCCCN(C(=O)OCc2ccccc2)CCCNC1=O |
| InChI | InChI=1S/C17H25N3O3/c18-15-9-4-5-11-20(12-6-10-19-16(15)21)17(22)23-13-14-7-2-1-3-8-14/h1-3,7-8,15H,4-6,9-13,18H2,(H,19,21) |
| InChIKey | IRRVJRIWNQHUHG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |