C18H25NO3 — CID 122530664
benzyl 4-cyclopropyl-4-hydroxyazocane-1-carboxylate (PubChem CID 122530664) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is benzyl 4-cyclopropyl-4-hydroxyazocane-1-carboxylate.
| Compound Name | benzyl 4-cyclopropyl-4-hydroxyazocane-1-carboxylate |
|---|---|
| PubChem CID | 122530664 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | benzyl 4-cyclopropyl-4-hydroxyazocane-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC(O)(C2CC2)CC1 |
| InChI | InChI=1S/C18H25NO3/c20-17(22-14-15-6-2-1-3-7-15)19-12-5-4-10-18(21,11-13-19)16-8-9-16/h1-3,6-7,16,21H,4-5,8-14H2 |
| InChIKey | XMCDOGREQKXDCL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |