C10H18N2O3 — CID 106673017
4-(3,4-dihydroxypyrrolidin-1-yl)azepan-2-one (PubChem CID 106673017) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is 4-(3,4-dihydroxypyrrolidin-1-yl)azepan-2-one.
| Compound Name | 4-(3,4-dihydroxypyrrolidin-1-yl)azepan-2-one |
|---|---|
| PubChem CID | 106673017 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 4-(3,4-dihydroxypyrrolidin-1-yl)azepan-2-one |
| SMILES | O=C1CC(N2CC(O)C(O)C2)CCCN1 |
| InChI | InChI=1S/C10H18N2O3/c13-8-5-12(6-9(8)14)7-2-1-3-11-10(15)4-7/h7-9,13-14H,1-6H2,(H,11,15) |
| InChIKey | UNKXEHXWFLWTRS-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |