C13H24N2O3 — CID 114779780
4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]azepan-2-one (PubChem CID 114779780) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]azepan-2-one.
| Compound Name | 4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 114779780 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 4-[6-(hydroxymethyl)-2,2-dimethylmorpholin-4-yl]azepan-2-one |
| SMILES | CC1(C)CN(C2CCCNC(=O)C2)CC(CO)O1 |
| InChI | InChI=1S/C13H24N2O3/c1-13(2)9-15(7-11(8-16)18-13)10-4-3-5-14-12(17)6-10/h10-11,16H,3-9H2,1-2H3,(H,14,17) |
| InChIKey | ULOTYWLDRVDFIY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |