About 5-aminoazepan-2-one;ethane
5-aminoazepan-2-one;ethane (PubChem CID 142912069) has the molecular formula C8H18N2O
and a molecular weight of 158.25 g/mol. Its IUPAC name is 5-aminoazepan-2-one;ethane.
Molecular Properties
| Compound Name | 5-aminoazepan-2-one;ethane |
| PubChem CID | 142912069 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.25 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 5-aminoazepan-2-one;ethane |
| SMILES | CC.NC1CCNC(=O)CC1 |
| InChI | InChI=1S/C6H12N2O.C2H6/c7-5-1-2-6(9)8-4-3-5;1-2/h5H,1-4,7H2,(H,8,9);1-2H3 |
| InChIKey | GWDOGOLZDOHPDG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-aminoazepan-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminoazepan-2-one;ethane?
The IUPAC name of 5-aminoazepan-2-one;ethane (CID 142912069) is 5-aminoazepan-2-one;ethane.
What is the SMILES notation for 5-aminoazepan-2-one;ethane?
The canonical SMILES for 5-aminoazepan-2-one;ethane is CC.NC1CCNC(=O)CC1.
What is the InChIKey of 5-aminoazepan-2-one;ethane?
The InChIKey is GWDOGOLZDOHPDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2H6/c7-5-1-2-6(9)8-4-3-5;1-2/h5H,1-4,7H2,(H,8,9);1-2H3.
What are the key properties of 5-aminoazepan-2-one;ethane?
5-aminoazepan-2-one;ethane has a molecular weight of 158.25 g/mol, XLogP of 0.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminoazepan-2-one;ethane is sourced from PubChem (CID 142912069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).