About methane;5-methylazepan-2-one
methane;5-methylazepan-2-one (PubChem CID 158920172) has the molecular formula C9H21NO
and a molecular weight of 159.27 g/mol. Its IUPAC name is methane;5-methylazepan-2-one.
Molecular Properties
| Compound Name | methane;5-methylazepan-2-one |
| PubChem CID | 158920172 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | methane;5-methylazepan-2-one |
| SMILES | C.C.CC1CCNC(=O)CC1 |
| InChI | InChI=1S/C7H13NO.2CH4/c1-6-2-3-7(9)8-5-4-6;;/h6H,2-5H2,1H3,(H,8,9);2*1H4 |
| InChIKey | JHSVISPPUUCRID-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methane;5-methylazepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;5-methylazepan-2-one?
The IUPAC name of methane;5-methylazepan-2-one (CID 158920172) is methane;5-methylazepan-2-one.
What is the SMILES notation for methane;5-methylazepan-2-one?
The canonical SMILES for methane;5-methylazepan-2-one is C.C.CC1CCNC(=O)CC1.
What is the InChIKey of methane;5-methylazepan-2-one?
The InChIKey is JHSVISPPUUCRID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.2CH4/c1-6-2-3-7(9)8-5-4-6;;/h6H,2-5H2,1H3,(H,8,9);2*1H4.
What are the key properties of methane;5-methylazepan-2-one?
methane;5-methylazepan-2-one has a molecular weight of 159.27 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methane;5-methylazepan-2-one is sourced from PubChem (CID 158920172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).