C8H10N2O2 — CID 70108846
1,2,3,3a,4,5-hexahydropyrrolo[3,2-c]azepine-6,7-dione (PubChem CID 70108846) has the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. Its IUPAC name is 1,2,3,3a,4,5-hexahydropyrrolo[3,2-c]azepine-6,7-dione.
| Compound Name | 1,2,3,3a,4,5-hexahydropyrrolo[3,2-c]azepine-6,7-dione |
|---|---|
| PubChem CID | 70108846 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 1,2,3,3a,4,5-hexahydropyrrolo[3,2-c]azepine-6,7-dione |
| SMILES | O=C1C=C2NCCC2CNC1=O |
| InChI | InChI=1S/C8H10N2O2/c11-7-3-6-5(1-2-9-6)4-10-8(7)12/h3,5,9H,1-2,4H2,(H,10,12) |
| InChIKey | FVYWLESKGQUGDG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|