C11H12N2 — CID 141172733
2,3,3a,4-tetrahydro-1H-pyrrolo[3,2-g]quinoline (PubChem CID 141172733) has the molecular formula C11H12N2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2,3,3a,4-tetrahydro-1H-pyrrolo[3,2-g]quinoline.
| Compound Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[3,2-g]quinoline |
|---|---|
| PubChem CID | 141172733 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2,3,3a,4-tetrahydro-1H-pyrrolo[3,2-g]quinoline |
| SMILES | C1=C2NCCC2Cc2cccnc21 |
| InChI | InChI=1S/C11H12N2/c1-2-8-6-9-3-5-13-11(9)7-10(8)12-4-1/h1-2,4,7,9,13H,3,5-6H2 |
| InChIKey | VQBWMWHFMWHNBU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |