C8H7NO — CID 19831889
5H-pyrano[4,3-b]pyridine (PubChem CID 19831889) has the molecular formula C8H7NO and a molecular weight of 133.15 g/mol. Its IUPAC name is 5H-pyrano[4,3-b]pyridine.
| Compound Name | 5H-pyrano[4,3-b]pyridine |
|---|---|
| PubChem CID | 19831889 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 5H-pyrano[4,3-b]pyridine |
| SMILES | C1=Cc2ncccc2CO1 |
| InChI | InChI=1S/C8H7NO/c1-2-7-6-10-5-3-8(7)9-4-1/h1-5H,6H2 |
| InChIKey | RMDFJPZSIHHQRG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |