About 5H-pyrido[2,3-c]azepine;dihydrochloride
5H-pyrido[2,3-c]azepine;dihydrochloride (PubChem CID 170312434) has the molecular formula C9H10Cl2N2
and a molecular weight of 217.10 g/mol. Its IUPAC name is 5H-pyrido[2,3-c]azepine;dihydrochloride.
Molecular Properties
| Compound Name | 5H-pyrido[2,3-c]azepine;dihydrochloride |
| PubChem CID | 170312434 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 5H-pyrido[2,3-c]azepine;dihydrochloride |
| SMILES | C1=CN=Cc2ncccc2C1.Cl.Cl |
| InChI | InChI=1S/C9H8N2.2ClH/c1-3-8-4-2-6-11-9(8)7-10-5-1;;/h1-2,4-7H,3H2;2*1H |
| InChIKey | DIEHAJQIAXBXNK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-pyrido[2,3-c]azepine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrido[2,3-c]azepine;dihydrochloride?
The IUPAC name of 5H-pyrido[2,3-c]azepine;dihydrochloride (CID 170312434) is 5H-pyrido[2,3-c]azepine;dihydrochloride.
What is the SMILES notation for 5H-pyrido[2,3-c]azepine;dihydrochloride?
The canonical SMILES for 5H-pyrido[2,3-c]azepine;dihydrochloride is C1=CN=Cc2ncccc2C1.Cl.Cl.
What is the InChIKey of 5H-pyrido[2,3-c]azepine;dihydrochloride?
The InChIKey is DIEHAJQIAXBXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.2ClH/c1-3-8-4-2-6-11-9(8)7-10-5-1;;/h1-2,4-7H,3H2;2*1H.
What are the key properties of 5H-pyrido[2,3-c]azepine;dihydrochloride?
5H-pyrido[2,3-c]azepine;dihydrochloride has a molecular weight of 217.10 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrido[2,3-c]azepine;dihydrochloride is sourced from PubChem (CID 170312434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).