About 5H-2-benzazepin-8-ol
5H-2-benzazepin-8-ol (PubChem CID 123680464) has the molecular formula C10H9NO
and a molecular weight of 159.19 g/mol. Its IUPAC name is 5H-2-benzazepin-8-ol.
Molecular Properties
| Compound Name | 5H-2-benzazepin-8-ol |
| PubChem CID | 123680464 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 5H-2-benzazepin-8-ol |
| SMILES | Oc1ccc2c(c1)C=NC=CC2 |
| InChI | InChI=1S/C10H9NO/c12-10-4-3-8-2-1-5-11-7-9(8)6-10/h1,3-7,12H,2H2 |
| InChIKey | UHSWZEZJTOBHLI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5H-2-benzazepin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-2-benzazepin-8-ol?
The IUPAC name of 5H-2-benzazepin-8-ol (CID 123680464) is 5H-2-benzazepin-8-ol.
What is the SMILES notation for 5H-2-benzazepin-8-ol?
The canonical SMILES for 5H-2-benzazepin-8-ol is Oc1ccc2c(c1)C=NC=CC2.
What is the InChIKey of 5H-2-benzazepin-8-ol?
The InChIKey is UHSWZEZJTOBHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO/c12-10-4-3-8-2-1-5-11-7-9(8)6-10/h1,3-7,12H,2H2.
What are the key properties of 5H-2-benzazepin-8-ol?
5H-2-benzazepin-8-ol has a molecular weight of 159.19 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-2-benzazepin-8-ol is sourced from PubChem (CID 123680464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).