About 2H-naphthalene-1,1,7-triol
2H-naphthalene-1,1,7-triol (PubChem CID 67563728) has the molecular formula C10H10O3
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2H-naphthalene-1,1,7-triol.
Molecular Properties
| Compound Name | 2H-naphthalene-1,1,7-triol |
| PubChem CID | 67563728 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 2H-naphthalene-1,1,7-triol |
| SMILES | Oc1ccc2c(c1)C(O)(O)CC=C2 |
| InChI | InChI=1S/C10H10O3/c11-8-4-3-7-2-1-5-10(12,13)9(7)6-8/h1-4,6,11-13H,5H2 |
| InChIKey | UVXPALGDJPFVPY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2H-naphthalene-1,1,7-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-naphthalene-1,1,7-triol?
The IUPAC name of 2H-naphthalene-1,1,7-triol (CID 67563728) is 2H-naphthalene-1,1,7-triol.
What is the SMILES notation for 2H-naphthalene-1,1,7-triol?
The canonical SMILES for 2H-naphthalene-1,1,7-triol is Oc1ccc2c(c1)C(O)(O)CC=C2.
What is the InChIKey of 2H-naphthalene-1,1,7-triol?
The InChIKey is UVXPALGDJPFVPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O3/c11-8-4-3-7-2-1-5-10(12,13)9(7)6-8/h1-4,6,11-13H,5H2.
What are the key properties of 2H-naphthalene-1,1,7-triol?
2H-naphthalene-1,1,7-triol has a molecular weight of 178.19 g/mol, XLogP of 0.95, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-naphthalene-1,1,7-triol is sourced from PubChem (CID 67563728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).