About sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol
sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol (PubChem CID 19751930) has the molecular formula C8H6NaO+
and a molecular weight of 141.12 g/mol. Its IUPAC name is sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol.
Analyze sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol?
The IUPAC name of sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol (CID 19751930) is sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol.
What is the SMILES notation for sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol?
The canonical SMILES for sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol is Oc1ccc2c(c1)C=C2.[Na+].
What is the InChIKey of sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol?
The InChIKey is FANXIZOBEHPOCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.Na/c9-8-4-3-6-1-2-7(6)5-8;/h1-5,9H;/q;+1.
What are the key properties of sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol?
sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol has a molecular weight of 141.12 g/mol, XLogP of -1.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium bicyclo[4.2.0]octa-1(6),2,4,7-tetraen-3-ol is sourced from PubChem (CID 19751930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).