C11H15N — CID 142006347
5,6-dihydroquinoline;ethane (PubChem CID 142006347) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 5,6-dihydroquinoline;ethane.
| Compound Name | 5,6-dihydroquinoline;ethane |
|---|---|
| PubChem CID | 142006347 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 5,6-dihydroquinoline;ethane |
| SMILES | C1=Cc2ncccc2CC1.CC |
| InChI | InChI=1S/C9H9N.C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-2/h2-3,5-7H,1,4H2;1-2H3 |
| InChIKey | DCZFUXQPASJHDR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |