About 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene
3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 66942014) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
Analyze 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene?
The IUPAC name of 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (CID 66942014) is 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
What is the SMILES notation for 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene?
The canonical SMILES for 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene is c1cnc2c(c1)CC1CC2CCN1.
What is the InChIKey of 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene?
The InChIKey is OCOWBDHXWBIGBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-2-8-6-10-7-9(3-5-12-10)11(8)13-4-1/h1-2,4,9-10,12H,3,5-7H2.
What are the key properties of 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene?
3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene has a molecular weight of 174.25 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,10-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene is sourced from PubChem (CID 66942014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).