About 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene
1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (PubChem CID 91328496) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene.
Analyze 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene?
The IUPAC name of 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (CID 91328496) is 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene.
What is the SMILES notation for 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene?
The canonical SMILES for 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene is c1cnc2c(c1)N1CCC2CC1.
What is the InChIKey of 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene?
The InChIKey is GTWFOBMUTJTKPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-9-10(11-5-1)8-3-6-12(9)7-4-8/h1-2,5,8H,3-4,6-7H2.
What are the key properties of 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene?
1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene has a molecular weight of 160.22 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene is sourced from PubChem (CID 91328496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).