About 3,4-diiodopiperidin-2-one
3,4-diiodopiperidin-2-one (PubChem CID 67270364) has the molecular formula C5H7I2NO
and a molecular weight of 350.93 g/mol. Its IUPAC name is 3,4-diiodopiperidin-2-one.
Molecular Properties
| Compound Name | 3,4-diiodopiperidin-2-one |
| PubChem CID | 67270364 |
| Molecular Formula | C5H7I2NO |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.86 |
| IUPAC Name | 3,4-diiodopiperidin-2-one |
| SMILES | O=C1NCCC(I)C1I |
| InChI | InChI=1S/C5H7I2NO/c6-3-1-2-8-5(9)4(3)7/h3-4H,1-2H2,(H,8,9) |
| InChIKey | CNRRHLUKFORHEL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diiodopiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diiodopiperidin-2-one?
The IUPAC name of 3,4-diiodopiperidin-2-one (CID 67270364) is 3,4-diiodopiperidin-2-one.
What is the SMILES notation for 3,4-diiodopiperidin-2-one?
The canonical SMILES for 3,4-diiodopiperidin-2-one is O=C1NCCC(I)C1I.
What is the InChIKey of 3,4-diiodopiperidin-2-one?
The InChIKey is CNRRHLUKFORHEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7I2NO/c6-3-1-2-8-5(9)4(3)7/h3-4H,1-2H2,(H,8,9).
What are the key properties of 3,4-diiodopiperidin-2-one?
3,4-diiodopiperidin-2-one has a molecular weight of 350.93 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diiodopiperidin-2-one is sourced from PubChem (CID 67270364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).