C5H7Br2NO — CID 67271185
3,4-dibromopiperidin-2-one (PubChem CID 67271185) has the molecular formula C5H7Br2NO and a molecular weight of 256.93 g/mol. Its IUPAC name is 3,4-dibromopiperidin-2-one.
| Compound Name | 3,4-dibromopiperidin-2-one |
|---|---|
| PubChem CID | 67271185 |
| Molecular Formula | C5H7Br2NO |
| Molecular Weight | 256.93 g/mol |
| Exact Mass | 254.89 |
| IUPAC Name | 3,4-dibromopiperidin-2-one |
| SMILES | O=C1NCCC(Br)C1Br |
| InChI | InChI=1S/C5H7Br2NO/c6-3-1-2-8-5(9)4(3)7/h3-4H,1-2H2,(H,8,9) |
| InChIKey | LIBSPQHHUCDLJZ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.93 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|