C10H14N2O4 — CID 143111075
N-[2-(hydroxymethyl)-5-oxo-2H-furan-3-yl]pyrrolidine-2-carboxamide (PubChem CID 143111075) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)-5-oxo-2H-furan-3-yl]pyrrolidine-2-carboxamide.
| Compound Name | N-[2-(hydroxymethyl)-5-oxo-2H-furan-3-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 143111075 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N-[2-(hydroxymethyl)-5-oxo-2H-furan-3-yl]pyrrolidine-2-carboxamide |
| SMILES | O=C1C=C(NC(=O)C2CCCN2)C(CO)O1 |
| InChI | InChI=1S/C10H14N2O4/c13-5-8-7(4-9(14)16-8)12-10(15)6-2-1-3-11-6/h4,6,8,11,13H,1-3,5H2,(H,12,15) |
| InChIKey | GSCUBNXNAFCNDL-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |