C6H9NO3 — CID 117273468
4-hydroxyazepane-2,3-dione (PubChem CID 117273468) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 4-hydroxyazepane-2,3-dione.
| Compound Name | 4-hydroxyazepane-2,3-dione |
|---|---|
| PubChem CID | 117273468 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 4-hydroxyazepane-2,3-dione |
| SMILES | O=C1NCCCC(O)C1=O |
| InChI | InChI=1S/C6H9NO3/c8-4-2-1-3-7-6(10)5(4)9/h4,8H,1-3H2,(H,7,10) |
| InChIKey | DNOKFTQUBVUAEU-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|