C6H8O4 — CID 123290269
(3R)-3,6-dihydroxycyclohexane-1,2-dione (PubChem CID 123290269) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is (3R)-3,6-dihydroxycyclohexane-1,2-dione.
| Compound Name | (3R)-3,6-dihydroxycyclohexane-1,2-dione |
|---|---|
| PubChem CID | 123290269 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (3R)-3,6-dihydroxycyclohexane-1,2-dione |
| SMILES | O=C1C(=O)[C@H](O)CCC1O |
| InChI | InChI=1S/C6H8O4/c7-3-1-2-4(8)6(10)5(3)9/h3-4,7-8H,1-2H2/t3-,4?/m1/s1 |
| InChIKey | SIUMBOSTVZXUPX-SYPWQXSBSA-N |
| XLogP | -1.36 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|