C5H7NO4 — CID 90948987
4,6-dihydroxypiperidine-2,3-dione (PubChem CID 90948987) has the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. Its IUPAC name is 4,6-dihydroxypiperidine-2,3-dione.
| Compound Name | 4,6-dihydroxypiperidine-2,3-dione |
|---|---|
| PubChem CID | 90948987 |
| Molecular Formula | C5H7NO4 |
| Molecular Weight | 145.11 g/mol |
| Exact Mass | 145.04 |
| IUPAC Name | 4,6-dihydroxypiperidine-2,3-dione |
| SMILES | O=C1NC(O)CC(O)C1=O |
| InChI | InChI=1S/C5H7NO4/c7-2-1-3(8)6-5(10)4(2)9/h2-3,7-8H,1H2,(H,6,10) |
| InChIKey | HBNAQJWLGBLVCL-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.11 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|