C5H9NO3 — CID 91327610
3,5-dihydroxypiperidin-4-one (PubChem CID 91327610) has the molecular formula C5H9NO3 and a molecular weight of 131.13 g/mol. Its IUPAC name is 3,5-dihydroxypiperidin-4-one.
| Compound Name | 3,5-dihydroxypiperidin-4-one |
|---|---|
| PubChem CID | 91327610 |
| Molecular Formula | C5H9NO3 |
| Molecular Weight | 131.13 g/mol |
| Exact Mass | 131.06 |
| IUPAC Name | 3,5-dihydroxypiperidin-4-one |
| SMILES | O=C1C(O)CNCC1O |
| InChI | InChI=1S/C5H9NO3/c7-3-1-6-2-4(8)5(3)9/h3-4,6-8H,1-2H2 |
| InChIKey | ZAXGGBHREOIWPW-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.13 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |