C7H9NO2 — CID 155668799
(1S,5R)-2-azabicyclo[3.2.1]octane-3,4-dione (PubChem CID 155668799) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is (1S,5R)-2-azabicyclo[3.2.1]octane-3,4-dione.
| Compound Name | (1S,5R)-2-azabicyclo[3.2.1]octane-3,4-dione |
|---|---|
| PubChem CID | 155668799 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | (1S,5R)-2-azabicyclo[3.2.1]octane-3,4-dione |
| SMILES | O=C1N[C@H]2CC[C@H](C2)C1=O |
| InChI | InChI=1S/C7H9NO2/c9-6-4-1-2-5(3-4)8-7(6)10/h4-5H,1-3H2,(H,8,10)/t4-,5+/m1/s1 |
| InChIKey | MBBBGAOLIFOIGW-UHNVWZDZSA-N |
| XLogP | -0.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|