C10H15NO3 — CID 54564519
3-hydroxy-5-piperidin-1-ylcyclopentane-1,2-dione (PubChem CID 54564519) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 3-hydroxy-5-piperidin-1-ylcyclopentane-1,2-dione.
| Compound Name | 3-hydroxy-5-piperidin-1-ylcyclopentane-1,2-dione |
|---|---|
| PubChem CID | 54564519 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 3-hydroxy-5-piperidin-1-ylcyclopentane-1,2-dione |
| SMILES | O=C1C(=O)C(N2CCCCC2)CC1O |
| InChI | InChI=1S/C10H15NO3/c12-8-6-7(9(13)10(8)14)11-4-2-1-3-5-11/h7-8,12H,1-6H2 |
| InChIKey | ZSWQOTXAVLVYGY-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|