C9H13NO3 — CID 54151225
5-(azetidin-1-yl)-3-hydroxy-3-methylcyclopentane-1,2-dione (PubChem CID 54151225) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-(azetidin-1-yl)-3-hydroxy-3-methylcyclopentane-1,2-dione.
| Compound Name | 5-(azetidin-1-yl)-3-hydroxy-3-methylcyclopentane-1,2-dione |
|---|---|
| PubChem CID | 54151225 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-(azetidin-1-yl)-3-hydroxy-3-methylcyclopentane-1,2-dione |
| SMILES | CC1(O)CC(N2CCC2)C(=O)C1=O |
| InChI | InChI=1S/C9H13NO3/c1-9(13)5-6(7(11)8(9)12)10-3-2-4-10/h6,13H,2-5H2,1H3 |
| InChIKey | OHWNQBNFIRTYON-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|