C6H9NO4 — CID 68848721
(2S,5R)-5-hydroxy-6-oxopiperidine-2-carboxylic acid (PubChem CID 68848721) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is (2S,5R)-5-hydroxy-6-oxopiperidine-2-carboxylic acid.
| Compound Name | (2S,5R)-5-hydroxy-6-oxopiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 68848721 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | (2S,5R)-5-hydroxy-6-oxopiperidine-2-carboxylic acid |
| SMILES | O=C1N[C@H](C(=O)O)CC[C@H]1O |
| InChI | InChI=1S/C6H9NO4/c8-4-2-1-3(6(10)11)7-5(4)9/h3-4,8H,1-2H2,(H,7,9)(H,10,11)/t3-,4+/m0/s1 |
| InChIKey | ANOKROFXQXVJAL-IUYQGCFVSA-N |
| XLogP | -1.29 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |