C6H11NO2 — CID 55287608
(3S,6S)-3-hydroxy-6-methylpiperidin-2-one (PubChem CID 55287608) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is (3S,6S)-3-hydroxy-6-methylpiperidin-2-one.
| Compound Name | (3S,6S)-3-hydroxy-6-methylpiperidin-2-one |
|---|---|
| PubChem CID | 55287608 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | (3S,6S)-3-hydroxy-6-methylpiperidin-2-one |
| SMILES | C[C@H]1CC[C@H](O)C(=O)N1 |
| InChI | InChI=1S/C6H11NO2/c1-4-2-3-5(8)6(9)7-4/h4-5,8H,2-3H2,1H3,(H,7,9)/t4-,5-/m0/s1 |
| InChIKey | ICTSFRZRPJLPQH-WHFBIAKZSA-N |
| XLogP | -0.35 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |