[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid

C8H14N2O3 — CID 155145749

IUPAC[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid
SMILESC[C@@H]1CCC[C@@H](NC(=O)O)C(=O)N1
InChIInChI=1S/C8H14N2O3/c1-5-3-2-4-6(7(11)9-5)10-8(12)13/h5-6,10H,2-4H2,1H3,(H,9,11)(H,12,13)/t5-,6-/m1/s1
InChIKeyAINCYUWTDFGQLN-PHDIDXHHSA-N
MW186.21 g/mol
LogP0.31
Rot. Bonds1

About [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid

[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid (PubChem CID 155145749) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid.

Molecular Properties

Compound Name[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid
PubChem CID155145749
Molecular FormulaC8H14N2O3
Molecular Weight186.21 g/mol
Exact Mass186.10
IUPAC Name[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid
SMILESC[C@@H]1CCC[C@@H](NC(=O)O)C(=O)N1
InChIInChI=1S/C8H14N2O3/c1-5-3-2-4-6(7(11)9-5)10-8(12)13/h5-6,10H,2-4H2,1H3,(H,9,11)(H,12,13)/t5-,6-/m1/s1
InChIKeyAINCYUWTDFGQLN-PHDIDXHHSA-N
XLogP0.31
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.21
LogP ≤ 50.31
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid?
The IUPAC name of [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid (CID 155145749) is [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid.
What is the SMILES notation for [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid?
The canonical SMILES for [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid is C[C@@H]1CCC[C@@H](NC(=O)O)C(=O)N1.
What is the InChIKey of [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid?
The InChIKey is AINCYUWTDFGQLN-PHDIDXHHSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-5-3-2-4-6(7(11)9-5)10-8(12)13/h5-6,10H,2-4H2,1H3,(H,9,11)(H,12,13)/t5-,6-/m1/s1.
What are the key properties of [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid?
[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid has a molecular weight of 186.21 g/mol, XLogP of 0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid is sourced from PubChem (CID 155145749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).