C8H14N2O3 — CID 155145749
[(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid (PubChem CID 155145749) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid.
| Compound Name | [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 155145749 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | [(3R,7R)-7-methyl-2-oxoazepan-3-yl]carbamic acid |
| SMILES | C[C@@H]1CCC[C@@H](NC(=O)O)C(=O)N1 |
| InChI | InChI=1S/C8H14N2O3/c1-5-3-2-4-6(7(11)9-5)10-8(12)13/h5-6,10H,2-4H2,1H3,(H,9,11)(H,12,13)/t5-,6-/m1/s1 |
| InChIKey | AINCYUWTDFGQLN-PHDIDXHHSA-N |
| XLogP | 0.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |