C19H21IN4O3 — CID 90313236
[(10R,14S)-5-amino-4-iodo-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-14-yl]carbamic acid (PubChem CID 90313236) has the molecular formula C19H21IN4O3 and a molecular weight of 480.31 g/mol. Its IUPAC name is [(10R,14S)-5-amino-4-iodo-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-14-yl]carbamic acid.
| Compound Name | [(10R,14S)-5-amino-4-iodo-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-14-yl]carbamic acid |
|---|---|
| PubChem CID | 90313236 |
| Molecular Formula | C19H21IN4O3 |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | [(10R,14S)-5-amino-4-iodo-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaen-14-yl]carbamic acid |
| SMILES | C[C@@H]1CCC[C@H](NC(=O)O)c2cc(ccn2)-c2cc(I)c(N)cc2NC1=O |
| InChI | InChI=1S/C19H21IN4O3/c1-10-3-2-4-15(24-19(26)27)17-7-11(5-6-22-17)12-8-13(20)14(21)9-16(12)23-18(10)25/h5-10,15,24H,2-4,21H2,1H3,(H,23,25)(H,26,27)/t10-,15+/m1/s1 |
| InChIKey | JQXVEZIGQRJQHL-BMIGLBTASA-N |
| XLogP | 4.00 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|