C24H31N3O4 — CID 126739846
tert-butyl N-[(10R,14S)-5-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl]carbamate (PubChem CID 126739846) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl N-[(10R,14S)-5-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[(10R,14S)-5-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl]carbamate |
|---|---|
| PubChem CID | 126739846 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | tert-butyl N-[(10R,14S)-5-methoxy-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-14-yl]carbamate |
| SMILES | COc1ccc2c(c1)NC(=O)[C@H](C)CCC[C@H](NC(=O)OC(C)(C)C)c1cc-2ccn1 |
| InChI | InChI=1S/C24H31N3O4/c1-15-7-6-8-19(27-23(29)31-24(2,3)4)21-13-16(11-12-25-21)18-10-9-17(30-5)14-20(18)26-22(15)28/h9-15,19H,6-8H2,1-5H3,(H,26,28)(H,27,29)/t15-,19+/m1/s1 |
| InChIKey | PGZRSLBRBNTHSC-BEFAXECRSA-N |
| XLogP | 5.08 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |