C23H27N3O3 — CID 140680609
tert-butyl N-[(10R,11Z,14S)-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate (PubChem CID 140680609) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is tert-butyl N-[(10R,11Z,14S)-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[(10R,11Z,14S)-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate |
|---|---|
| PubChem CID | 140680609 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl N-[(10R,11Z,14S)-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,11,15,17-heptaen-14-yl]carbamate |
| SMILES | C[C@@H]1/C=C\C[C@H](NC(=O)OC(C)(C)C)c2cc(ccn2)-c2ccccc2NC1=O |
| InChI | InChI=1S/C23H27N3O3/c1-15-8-7-11-19(26-22(28)29-23(2,3)4)20-14-16(12-13-24-20)17-9-5-6-10-18(17)25-21(15)27/h5-10,12-15,19H,11H2,1-4H3,(H,25,27)(H,26,28)/b8-7-/t15-,19+/m1/s1 |
| InChIKey | BGYAIAZCFIAFQY-LOSCMBPPSA-N |
| XLogP | 4.85 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|