C25H29F3N4O4 — CID 66744990
tert-butyl N-[5-(methoxycarbonylamino)-9-(trifluoromethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaen-14-yl]carbamate (PubChem CID 66744990) has the molecular formula C25H29F3N4O4 and a molecular weight of 506.53 g/mol. Its IUPAC name is tert-butyl N-[5-(methoxycarbonylamino)-9-(trifluoromethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaen-14-yl]carbamate.
| Compound Name | tert-butyl N-[5-(methoxycarbonylamino)-9-(trifluoromethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaen-14-yl]carbamate |
|---|---|
| PubChem CID | 66744990 |
| Molecular Formula | C25H29F3N4O4 |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | tert-butyl N-[5-(methoxycarbonylamino)-9-(trifluoromethyl)-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaen-14-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(C(F)(F)F)CC=CCC(NC(=O)OC(C)(C)C)c1cc-2ccn1 |
| InChI | InChI=1S/C25H29F3N4O4/c1-24(2,3)36-23(34)32-18-7-5-6-8-21(25(26,27)28)31-19-14-16(30-22(33)35-4)9-10-17(19)15-11-12-29-20(18)13-15/h5-6,9-14,18,21,31H,7-8H2,1-4H3,(H,30,33)(H,32,34) |
| InChIKey | PMJVBZVBKIWDCX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|