C32H42N4O8 — CID 66744223
8-O-tert-butyl 9-O-ethyl (9S,11E)-5-(methoxycarbonylamino)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaene-8,9-dicarboxylate (PubChem CID 66744223) has the molecular formula C32H42N4O8 and a molecular weight of 610.71 g/mol. Its IUPAC name is 8-O-tert-butyl 9-O-ethyl (9S,11E)-5-(methoxycarbonylamino)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaene-8,9-dicarboxylate.
| Compound Name | 8-O-tert-butyl 9-O-ethyl (9S,11E)-5-(methoxycarbonylamino)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 66744223 |
| Molecular Formula | C32H42N4O8 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 8-O-tert-butyl 9-O-ethyl (9S,11E)-5-(methoxycarbonylamino)-14-[(2-methylpropan-2-yl)oxycarbonylamino]-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,11,15,17-heptaene-8,9-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1C/C=C/CC(NC(=O)OC(C)(C)C)c2cc(ccn2)-c2ccc(NC(=O)OC)cc2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H42N4O8/c1-9-42-27(37)25-13-11-10-12-23(35-29(39)43-31(2,3)4)24-18-20(16-17-33-24)22-15-14-21(34-28(38)41-8)19-26(22)36(25)30(40)44-32(5,6)7/h10-11,14-19,23,25H,9,12-13H2,1-8H3,(H,34,38)(H,35,39)/b11-10+/t23?,25-/m0/s1 |
| InChIKey | YVMBFVZZAZITPC-LONHXRNMSA-N |
| XLogP | 6.52 |
| TPSA | 145.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|