C28H35N5O4 — CID 66745120
methyl N-[(12E,15S)-15-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]carbamate (PubChem CID 66745120) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is methyl N-[(12E,15S)-15-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]carbamate.
| Compound Name | methyl N-[(12E,15S)-15-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]carbamate |
|---|---|
| PubChem CID | 66745120 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | methyl N-[(12E,15S)-15-[[4-(aminomethyl)cyclohexanecarbonyl]amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CC/C=C\C[C@H](NC(=O)C1CCC(CN)CC1)c1cc-2ccn1 |
| InChI | InChI=1S/C28H35N5O4/c1-37-28(36)31-21-11-12-22-20-13-14-30-25(15-20)23(5-3-2-4-6-26(34)32-24(22)16-21)33-27(35)19-9-7-18(17-29)8-10-19/h2-3,11-16,18-19,23H,4-10,17,29H2,1H3,(H,31,36)(H,32,34)(H,33,35)/b3-2-/t18?,19?,23-/m0/s1 |
| InChIKey | INLDCFHHGYOZPO-RHCXEIRJSA-N |
| XLogP | 4.53 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|