C29H29N5O4 — CID 157084464
methyl 2-[(12E,15S)-15-[(4-carbamimidoylbenzoyl)amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]acetate (PubChem CID 157084464) has the molecular formula C29H29N5O4 and a molecular weight of 511.58 g/mol. Its IUPAC name is methyl 2-[(12E,15S)-15-[(4-carbamimidoylbenzoyl)amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]acetate.
| Compound Name | methyl 2-[(12E,15S)-15-[(4-carbamimidoylbenzoyl)amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]acetate |
|---|---|
| PubChem CID | 157084464 |
| Molecular Formula | C29H29N5O4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | methyl 2-[(12E,15S)-15-[(4-carbamimidoylbenzoyl)amino]-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaen-5-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)N[C@H]2C/C=C\CCC(=O)Nc3cc(CC(=O)OC)ccc3-c3ccnc2c3)cc1 |
| InChI | InChI=1S/C29H29N5O4/c1-38-27(36)16-18-7-12-22-21-13-14-32-25(17-21)23(5-3-2-4-6-26(35)33-24(22)15-18)34-29(37)20-10-8-19(9-11-20)28(30)31/h2-3,7-15,17,23H,4-6,16H2,1H3,(H3,30,31)(H,33,35)(H,34,37)/b3-2-/t23-/m0/s1 |
| InChIKey | ADXVOMUTMVNOLQ-PPUPXGMHSA-N |
| XLogP | 3.90 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|