C30H31ClN4O4 — CID 146999906
methyl 2-[(12E,15S)-15-[4-(3-chlorophenyl)-2-oxopiperidin-1-yl]-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-5-yl]acetate (PubChem CID 146999906) has the molecular formula C30H31ClN4O4 and a molecular weight of 547.06 g/mol. Its IUPAC name is methyl 2-[(12E,15S)-15-[4-(3-chlorophenyl)-2-oxopiperidin-1-yl]-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-5-yl]acetate.
| Compound Name | methyl 2-[(12E,15S)-15-[4-(3-chlorophenyl)-2-oxopiperidin-1-yl]-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-5-yl]acetate |
|---|---|
| PubChem CID | 146999906 |
| Molecular Formula | C30H31ClN4O4 |
| Molecular Weight | 547.06 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | methyl 2-[(12E,15S)-15-[4-(3-chlorophenyl)-2-oxopiperidin-1-yl]-9-oxo-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)NC(=O)CC/C=C/C[C@H](N1CCC(c3cccc(Cl)c3)CC1=O)c1ncc-2[nH]1 |
| InChI | InChI=1S/C30H31ClN4O4/c1-39-29(38)15-19-10-11-23-24(14-19)33-27(36)9-4-2-3-8-26(30-32-18-25(23)34-30)35-13-12-21(17-28(35)37)20-6-5-7-22(31)16-20/h2-3,5-7,10-11,14,16,18,21,26H,4,8-9,12-13,15,17H2,1H3,(H,32,34)(H,33,36)/b3-2+/t21?,26-/m0/s1 |
| InChIKey | ARVIHABAMGQMFQ-NGRWXHIOSA-N |
| XLogP | 5.57 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.06 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|