C16H19N5O — CID 155029074
(12E,15S)-5,15-diamino-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-9-one (PubChem CID 155029074) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is (12E,15S)-5,15-diamino-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-9-one.
| Compound Name | (12E,15S)-5,15-diamino-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-9-one |
|---|---|
| PubChem CID | 155029074 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (12E,15S)-5,15-diamino-8,17,19-triazatricyclo[14.2.1.02,7]nonadeca-1(18),2(7),3,5,12,16-hexaen-9-one |
| SMILES | Nc1ccc2c(c1)NC(=O)CC/C=C/C[C@H](N)c1ncc-2[nH]1 |
| InChI | InChI=1S/C16H19N5O/c17-10-6-7-11-13(8-10)20-15(22)5-3-1-2-4-12(18)16-19-9-14(11)21-16/h1-2,6-9,12H,3-5,17-18H2,(H,19,21)(H,20,22)/b2-1+/t12-/m0/s1 |
| InChIKey | DPZSEAHTIVYKBF-ISUDXETCSA-N |
| XLogP | 2.34 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|