C27H27ClN6O4 — CID 145303920
(4R)-1'-[(14S)-5-amino-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-14-carbonyl]-6-chlorospiro[1H-3,1-benzoxazine-4,3'-pyrrolidine]-2-one (PubChem CID 145303920) has the molecular formula C27H27ClN6O4 and a molecular weight of 535.00 g/mol. Its IUPAC name is (4R)-1'-[(14S)-5-amino-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-14-carbonyl]-6-chlorospiro[1H-3,1-benzoxazine-4,3'-pyrrolidine]-2-one.
| Compound Name | (4R)-1'-[(14S)-5-amino-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-14-carbonyl]-6-chlorospiro[1H-3,1-benzoxazine-4,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 145303920 |
| Molecular Formula | C27H27ClN6O4 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | (4R)-1'-[(14S)-5-amino-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaene-14-carbonyl]-6-chlorospiro[1H-3,1-benzoxazine-4,3'-pyrrolidine]-2-one |
| SMILES | Nc1ccc2c(c1)NC(=O)CCCC[C@H](C(=O)N1CC[C@@]3(C1)OC(=O)Nc1ccc(Cl)cc13)c1ncc-2[nH]1 |
| InChI | InChI=1S/C27H27ClN6O4/c28-15-5-8-20-19(11-15)27(38-26(37)33-20)9-10-34(14-27)25(36)18-3-1-2-4-23(35)31-21-12-16(29)6-7-17(21)22-13-30-24(18)32-22/h5-8,11-13,18H,1-4,9-10,14,29H2,(H,30,32)(H,31,35)(H,33,37)/t18-,27-/m0/s1 |
| InChIKey | CLJNUNWBOBUZEF-MYUZEXMDSA-N |
| XLogP | 4.60 |
| TPSA | 142.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|