C18H20N4O2 — CID 140602272
2-[(14S)-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15-pentaen-14-yl]prop-2-enamide (PubChem CID 140602272) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(14S)-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15-pentaen-14-yl]prop-2-enamide.
| Compound Name | 2-[(14S)-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15-pentaen-14-yl]prop-2-enamide |
|---|---|
| PubChem CID | 140602272 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[(14S)-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2,4,6,15-pentaen-14-yl]prop-2-enamide |
| SMILES | C=C(C(N)=O)[C@@H]1CCCCC(=O)Nc2ccccc2-c2cnc1[nH]2 |
| InChI | InChI=1S/C18H20N4O2/c1-11(17(19)24)12-6-3-5-9-16(23)21-14-8-4-2-7-13(14)15-10-20-18(12)22-15/h2,4,7-8,10,12H,1,3,5-6,9H2,(H2,19,24)(H,20,22)(H,21,23)/t12-/m0/s1 |
| InChIKey | UVJASBHRQOAIJG-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|