C30H41N5O4 — CID 144902681
4-ethyl-2-[2-[(5-methoxy-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl)-methylamino]ethyl]benzaldehyde;formaldehyde;methanamine (PubChem CID 144902681) has the molecular formula C30H41N5O4 and a molecular weight of 535.69 g/mol. Its IUPAC name is 4-ethyl-2-[2-[(5-methoxy-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl)-methylamino]ethyl]benzaldehyde;formaldehyde;methanamine.
| Compound Name | 4-ethyl-2-[2-[(5-methoxy-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl)-methylamino]ethyl]benzaldehyde;formaldehyde;methanamine |
|---|---|
| PubChem CID | 144902681 |
| Molecular Formula | C30H41N5O4 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | 4-ethyl-2-[2-[(5-methoxy-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-14-yl)-methylamino]ethyl]benzaldehyde;formaldehyde;methanamine |
| SMILES | C=O.CCc1ccc(C=O)c(CCN(C)C2CCCCC(=O)Nc3cc(OC)ccc3-c3cnc2[nH]3)c1.CN |
| InChI | InChI=1S/C28H34N4O3.CH5N.CH2O/c1-4-19-9-10-21(18-33)20(15-19)13-14-32(2)26-7-5-6-8-27(34)30-24-16-22(35-3)11-12-23(24)25-17-29-28(26)31-25;2*1-2/h9-12,15-18,26H,4-8,13-14H2,1-3H3,(H,29,31)(H,30,34);2H2,1H3;1H2 |
| InChIKey | SRXCNJXOMPYKPC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 130.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|