C16H17N5O4 — CID 129199784
(14-formamido-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl) nitrite (PubChem CID 129199784) has the molecular formula C16H17N5O4 and a molecular weight of 343.34 g/mol. Its IUPAC name is (14-formamido-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl) nitrite.
| Compound Name | (14-formamido-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl) nitrite |
|---|---|
| PubChem CID | 129199784 |
| Molecular Formula | C16H17N5O4 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (14-formamido-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl) nitrite |
| SMILES | O=CNC1CCCCC(=O)Nc2cc(ON=O)ccc2-c2cnc1[nH]2 |
| InChI | InChI=1S/C16H17N5O4/c22-9-18-12-3-1-2-4-15(23)19-13-7-10(25-21-24)5-6-11(13)14-8-17-16(12)20-14/h5-9,12H,1-4H2,(H,17,20)(H,18,22)(H,19,23) |
| InChIKey | RGOICRIVRQKXRS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|