C27H25ClF2N6O5 — CID 78055914
methyl N-[14-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate (PubChem CID 78055914) has the molecular formula C27H25ClF2N6O5 and a molecular weight of 586.98 g/mol. Its IUPAC name is methyl N-[14-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[14-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 78055914 |
| Molecular Formula | C27H25ClF2N6O5 |
| Molecular Weight | 586.98 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | methyl N-[14-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)CCCCC(N1CCN(c3c(F)ccc(Cl)c3F)C(=O)C1=O)c1ncc-2[nH]1 |
| InChI | InChI=1S/C27H25ClF2N6O5/c1-41-27(40)32-14-6-7-15-18(12-14)33-21(37)5-3-2-4-20(24-31-13-19(15)34-24)35-10-11-36(26(39)25(35)38)23-17(29)9-8-16(28)22(23)30/h6-9,12-13,20H,2-5,10-11H2,1H3,(H,31,34)(H,32,40)(H,33,37) |
| InChIKey | OFOWAIBGDPBFMC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 136.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|