C31H30ClF2N5O5 — CID 123505010
methyl N-[15-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate (PubChem CID 123505010) has the molecular formula C31H30ClF2N5O5 and a molecular weight of 626.06 g/mol. Its IUPAC name is methyl N-[15-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate.
| Compound Name | methyl N-[15-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
|---|---|
| PubChem CID | 123505010 |
| Molecular Formula | C31H30ClF2N5O5 |
| Molecular Weight | 626.06 g/mol |
| Exact Mass | 625.19 |
| IUPAC Name | methyl N-[15-[4-(3-chloro-2,6-difluorophenyl)-2,3-dioxopiperazin-1-yl]-10-methyl-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,16,18-hexaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC(=O)C(C)CCCCC(N1CCN(c3c(F)ccc(Cl)c3F)C(=O)C1=O)c1cc-2ccn1 |
| InChI | InChI=1S/C31H30ClF2N5O5/c1-17-5-3-4-6-25(38-13-14-39(30(42)29(38)41)27-22(33)10-9-21(32)26(27)34)24-15-18(11-12-35-24)20-8-7-19(36-31(43)44-2)16-23(20)37-28(17)40/h7-12,15-17,25H,3-6,13-14H2,1-2H3,(H,36,43)(H,37,40) |
| InChIKey | HETWEHFZKGKXKI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.06 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|