C28H25ClF4N4O5 — CID 148536551
methyl 2-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-10,10-difluoro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate (PubChem CID 148536551) has the molecular formula C28H25ClF4N4O5 and a molecular weight of 608.98 g/mol. Its IUPAC name is methyl 2-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-10,10-difluoro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate.
| Compound Name | methyl 2-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-10,10-difluoro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate |
|---|---|
| PubChem CID | 148536551 |
| Molecular Formula | C28H25ClF4N4O5 |
| Molecular Weight | 608.98 g/mol |
| Exact Mass | 608.14 |
| IUPAC Name | methyl 2-[(14S)-14-[(6R)-6-(3-chloro-2,6-difluorophenyl)-2-oxo-1,3-oxazinan-3-yl]-10,10-difluoro-9-oxo-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2c(c1)NC(=O)C(F)(F)CCC[C@H](N1CC[C@H](c3c(F)ccc(Cl)c3F)OC1=O)c1ncc-2[nH]1 |
| InChI | InChI=1S/C28H25ClF4N4O5/c1-41-22(38)12-14-4-5-15-18(11-14)36-26(39)28(32,33)9-2-3-20(25-34-13-19(15)35-25)37-10-8-21(42-27(37)40)23-17(30)7-6-16(29)24(23)31/h4-7,11,13,20-21H,2-3,8-10,12H2,1H3,(H,34,35)(H,36,39)/t20-,21+/m0/s1 |
| InChIKey | MRIHUQNSRMAJKQ-LEWJYISDSA-N |
| XLogP | 6.11 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.98 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|